C35H37BO4 — CID 11627938
(4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-2-[(3S)-pent-1-en-3-yl]-1,3,2-dioxaborolane (PubChem CID 11627938) has the molecular formula C35H37BO4 and a molecular weight of 532.49 g/mol. Its IUPAC name is (4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-2-[(3S)-pent-1-en-3-yl]-1,3,2-dioxaborolane.
| Compound Name | (4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-2-[(3S)-pent-1-en-3-yl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 11627938 |
| Molecular Formula | C35H37BO4 |
| Molecular Weight | 532.49 g/mol |
| Exact Mass | 532.28 |
| IUPAC Name | (4R,5R)-4,5-bis[methoxy(diphenyl)methyl]-2-[(3S)-pent-1-en-3-yl]-1,3,2-dioxaborolane |
| SMILES | C=C[C@H](CC)B1O[C@@H](C(OC)(c2ccccc2)c2ccccc2)[C@H](C(OC)(c2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C35H37BO4/c1-5-31(6-2)36-39-32(34(37-3,27-19-11-7-12-20-27)28-21-13-8-14-22-28)33(40-36)35(38-4,29-23-15-9-16-24-29)30-25-17-10-18-26-30/h5,7-26,31-33H,1,6H2,2-4H3/t31-,32-,33-/m1/s1 |
| InChIKey | PKTGBXUYJYRBJP-WRVRXEDSSA-N |
| XLogP | 7.41 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.49 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|