C26H35F2N3O5Si — CID 11627997
[(2R,4R,5R)-2-azido-6-[tert-butyl(dimethyl)silyl]oxy-3,3-difluoro-5-hydroxy-4-phenylmethoxyhexyl] benzoate (PubChem CID 11627997) has the molecular formula C26H35F2N3O5Si and a molecular weight of 535.66 g/mol. Its IUPAC name is [(2R,4R,5R)-2-azido-6-[tert-butyl(dimethyl)silyl]oxy-3,3-difluoro-5-hydroxy-4-phenylmethoxyhexyl] benzoate.
| Compound Name | [(2R,4R,5R)-2-azido-6-[tert-butyl(dimethyl)silyl]oxy-3,3-difluoro-5-hydroxy-4-phenylmethoxyhexyl] benzoate |
|---|---|
| PubChem CID | 11627997 |
| Molecular Formula | C26H35F2N3O5Si |
| Molecular Weight | 535.66 g/mol |
| Exact Mass | 535.23 |
| IUPAC Name | [(2R,4R,5R)-2-azido-6-[tert-butyl(dimethyl)silyl]oxy-3,3-difluoro-5-hydroxy-4-phenylmethoxyhexyl] benzoate |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H](O)[C@@H](OCc1ccccc1)C(F)(F)[C@@H](COC(=O)c1ccccc1)N=[N+]=[N-] |
| InChI | InChI=1S/C26H35F2N3O5Si/c1-25(2,3)37(4,5)36-17-21(32)23(34-16-19-12-8-6-9-13-19)26(27,28)22(30-31-29)18-35-24(33)20-14-10-7-11-15-20/h6-15,21-23,32H,16-18H2,1-5H3/t21-,22-,23-/m1/s1 |
| InChIKey | HJSPMSAEXDDBPR-DNVJHFABSA-N |
| XLogP | 6.13 |
| TPSA | 113.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.66 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|