C30H50O7Si — CID 11628177
[(1R,2S,3R,4R,7R,8R,10E,14R)-3-(2-acetyloxypropan-2-yl)-10-(hydroxymethyl)-6,14-dimethyl-14-triethylsilyloxy-15-oxatricyclo[6.6.1.02,7]pentadeca-5,10-dien-4-yl] acetate (PubChem CID 11628177) has the molecular formula C30H50O7Si and a molecular weight of 550.81 g/mol. Its IUPAC name is [(1R,2S,3R,4R,7R,8R,10E,14R)-3-(2-acetyloxypropan-2-yl)-10-(hydroxymethyl)-6,14-dimethyl-14-triethylsilyloxy-15-oxatricyclo[6.6.1.02,7]pentadeca-5,10-dien-4-yl] acetate.
| Compound Name | [(1R,2S,3R,4R,7R,8R,10E,14R)-3-(2-acetyloxypropan-2-yl)-10-(hydroxymethyl)-6,14-dimethyl-14-triethylsilyloxy-15-oxatricyclo[6.6.1.02,7]pentadeca-5,10-dien-4-yl] acetate |
|---|---|
| PubChem CID | 11628177 |
| Molecular Formula | C30H50O7Si |
| Molecular Weight | 550.81 g/mol |
| Exact Mass | 550.33 |
| IUPAC Name | [(1R,2S,3R,4R,7R,8R,10E,14R)-3-(2-acetyloxypropan-2-yl)-10-(hydroxymethyl)-6,14-dimethyl-14-triethylsilyloxy-15-oxatricyclo[6.6.1.02,7]pentadeca-5,10-dien-4-yl] acetate |
| SMILES | CC[Si](CC)(CC)O[C@]1(C)CC/C=C(/CO)C[C@H]2O[C@@H]1[C@H]1[C@@H]2C(C)=C[C@@H](OC(C)=O)[C@@H]1C(C)(C)OC(C)=O |
| InChI | InChI=1S/C30H50O7Si/c1-10-38(11-2,12-3)37-30(9)15-13-14-22(18-31)17-23-25-19(4)16-24(34-20(5)32)27(26(25)28(30)35-23)29(7,8)36-21(6)33/h14,16,23-28,31H,10-13,15,17-18H2,1-9H3/b22-14+/t23-,24-,25-,26+,27+,28-,30-/m1/s1 |
| InChIKey | HBPPNRPDXOBFLV-QIPKZOKFSA-N |
| XLogP | 5.72 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.81 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|