C32H40O5SSi — CID 11628320
2-[(2R,6R)-6-[2-(benzenesulfonyl)ethyl]-6-methoxy-2,5-dihydropyran-2-yl]ethoxy-tert-butyl-diphenylsilane (PubChem CID 11628320) has the molecular formula C32H40O5SSi and a molecular weight of 564.82 g/mol. Its IUPAC name is 2-[(2R,6R)-6-[2-(benzenesulfonyl)ethyl]-6-methoxy-2,5-dihydropyran-2-yl]ethoxy-tert-butyl-diphenylsilane.
| Compound Name | 2-[(2R,6R)-6-[2-(benzenesulfonyl)ethyl]-6-methoxy-2,5-dihydropyran-2-yl]ethoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 11628320 |
| Molecular Formula | C32H40O5SSi |
| Molecular Weight | 564.82 g/mol |
| Exact Mass | 564.24 |
| IUPAC Name | 2-[(2R,6R)-6-[2-(benzenesulfonyl)ethyl]-6-methoxy-2,5-dihydropyran-2-yl]ethoxy-tert-butyl-diphenylsilane |
| SMILES | CO[C@]1(CCS(=O)(=O)c2ccccc2)CC=C[C@@H](CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1 |
| InChI | InChI=1S/C32H40O5SSi/c1-31(2,3)39(29-18-10-6-11-19-29,30-20-12-7-13-21-30)36-25-22-27-15-14-23-32(35-4,37-27)24-26-38(33,34)28-16-8-5-9-17-28/h5-21,27H,22-26H2,1-4H3/t27-,32+/m0/s1 |
| InChIKey | SBZNTIYSLBDZFW-QVWWMRLHSA-N |
| XLogP | 5.50 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.82 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|