C35H54O6 — CID 11628376
2-[(2R,4R,6R)-6-[(2R)-3-[(2S,6S)-6-[(2R)-2-hydroxydodec-11-ynyl]oxan-2-yl]-2-methoxypropyl]-4-phenylmethoxyoxan-2-yl]acetaldehyde (PubChem CID 11628376) has the molecular formula C35H54O6 and a molecular weight of 570.81 g/mol. Its IUPAC name is 2-[(2R,4R,6R)-6-[(2R)-3-[(2S,6S)-6-[(2R)-2-hydroxydodec-11-ynyl]oxan-2-yl]-2-methoxypropyl]-4-phenylmethoxyoxan-2-yl]acetaldehyde.
| Compound Name | 2-[(2R,4R,6R)-6-[(2R)-3-[(2S,6S)-6-[(2R)-2-hydroxydodec-11-ynyl]oxan-2-yl]-2-methoxypropyl]-4-phenylmethoxyoxan-2-yl]acetaldehyde |
|---|---|
| PubChem CID | 11628376 |
| Molecular Formula | C35H54O6 |
| Molecular Weight | 570.81 g/mol |
| Exact Mass | 570.39 |
| IUPAC Name | 2-[(2R,4R,6R)-6-[(2R)-3-[(2S,6S)-6-[(2R)-2-hydroxydodec-11-ynyl]oxan-2-yl]-2-methoxypropyl]-4-phenylmethoxyoxan-2-yl]acetaldehyde |
| SMILES | C#CCCCCCCCC[C@@H](O)C[C@@H]1CCC[C@@H](C[C@H](C[C@@H]2C[C@@H](OCc3ccccc3)C[C@H](CC=O)O2)OC)O1 |
| InChI | InChI=1S/C35H54O6/c1-3-4-5-6-7-8-9-13-17-29(37)22-30-18-14-19-31(40-30)23-33(38-2)25-35-26-34(24-32(41-35)20-21-36)39-27-28-15-11-10-12-16-28/h1,10-12,15-16,21,29-35,37H,4-9,13-14,17-20,22-27H2,2H3/t29-,30+,31+,32+,33-,34+,35-/m1/s1 |
| InChIKey | JUMXPHVBQNDDRM-XQXQMJHESA-N |
| XLogP | 6.95 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.81 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|