C24H38N18O2 — CID 11628682
2-[(1R,2R,4S,5S)-2,4-bis[2,4-bis(diaminomethylideneamino)phenoxy]-5-(diaminomethylideneamino)cyclohexyl]guanidine (PubChem CID 11628682) has the molecular formula C24H38N18O2 and a molecular weight of 610.69 g/mol. Its IUPAC name is 2-[(1R,2R,4S,5S)-2,4-bis[2,4-bis(diaminomethylideneamino)phenoxy]-5-(diaminomethylideneamino)cyclohexyl]guanidine.
| Compound Name | 2-[(1R,2R,4S,5S)-2,4-bis[2,4-bis(diaminomethylideneamino)phenoxy]-5-(diaminomethylideneamino)cyclohexyl]guanidine |
|---|---|
| PubChem CID | 11628682 |
| Molecular Formula | C24H38N18O2 |
| Molecular Weight | 610.69 g/mol |
| Exact Mass | 610.34 |
| IUPAC Name | 2-[(1R,2R,4S,5S)-2,4-bis[2,4-bis(diaminomethylideneamino)phenoxy]-5-(diaminomethylideneamino)cyclohexyl]guanidine |
| SMILES | NC(N)=Nc1ccc(O[C@H]2C[C@@H](Oc3ccc(N=C(N)N)cc3N=C(N)N)[C@H](N=C(N)N)C[C@@H]2N=C(N)N)c(N=C(N)N)c1 |
| InChI | InChI=1S/C24H38N18O2/c25-19(26)37-9-1-3-15(11(5-9)39-21(29)30)43-17-8-18(14(42-24(35)36)7-13(17)41-23(33)34)44-16-4-2-10(38-20(27)28)6-12(16)40-22(31)32/h1-6,13-14,17-18H,7-8H2,(H4,25,26,37)(H4,27,28,38)(H4,29,30,39)(H4,31,32,40)(H4,33,34,41)(H4,35,36,42)/t13-,14+,17-,18+ |
| InChIKey | SWPCXTNDGTURLE-MHGIMSBQSA-N |
| XLogP | -3.42 |
| TPSA | 404.86 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.69 |
| LogP ≤ 5 | -3.42 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|