C44H50N4OSiZn — CID 11629152
zinc (1Z)-1-[17,17-dimethyl-5-(2,4,6-trimethylphenyl)-12-[2-tri(propan-2-yl)silylethynyl]-18H-porphyrin-21-id-2-ylidene]ethanolate (PubChem CID 11629152) has the molecular formula C44H50N4OSiZn and a molecular weight of 744.39 g/mol. Its IUPAC name is zinc (1Z)-1-[17,17-dimethyl-5-(2,4,6-trimethylphenyl)-12-[2-tri(propan-2-yl)silylethynyl]-18H-porphyrin-21-id-2-ylidene]ethanolate.
| Compound Name | zinc (1Z)-1-[17,17-dimethyl-5-(2,4,6-trimethylphenyl)-12-[2-tri(propan-2-yl)silylethynyl]-18H-porphyrin-21-id-2-ylidene]ethanolate |
|---|---|
| PubChem CID | 11629152 |
| Molecular Formula | C44H50N4OSiZn |
| Molecular Weight | 744.39 g/mol |
| Exact Mass | 742.30 |
| IUPAC Name | zinc (1Z)-1-[17,17-dimethyl-5-(2,4,6-trimethylphenyl)-12-[2-tri(propan-2-yl)silylethynyl]-18H-porphyrin-21-id-2-ylidene]ethanolate |
| SMILES | C/C([O-])=c1\cc2[n-]\c1=C/C1=N/C(=C\C3=N/C(=C\C4=N/C(=C\2c2c(C)cc(C)cc2C)C=C4)C(C#C[Si](C(C)C)(C(C)C)C(C)C)=C3)C(C)(C)C1.[Zn+2] |
| InChI | InChI=1S/C44H51N4OSi.Zn/c1-25(2)50(26(3)4,27(5)6)16-15-32-19-34-22-41-44(11,12)24-35(47-41)21-39-36(31(10)49)23-40(48-39)43(42-29(8)17-28(7)18-30(42)9)37-14-13-33(45-37)20-38(32)46-34;/h13-14,17-23,25-27H,24H2,1-12H3,(H-,45,46,47,48,49);/q-1;+2/p-1 |
| InChIKey | GHZAMYRLMWRULZ-UHFFFAOYSA-M |
| XLogP | 7.86 |
| TPSA | 74.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.39 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|