C48H43N3O10 — CID 11629259
[(2R,3R,4R,5R)-2-(4-benzamido-2-oxopyrimidin-1-yl)-3,4-bis[(4-methylbenzoyl)oxy]-5-(phenylmethoxymethyl)oxolan-2-yl]methyl 4-methylbenzoate (PubChem CID 11629259) has the molecular formula C48H43N3O10 and a molecular weight of 821.88 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-2-(4-benzamido-2-oxopyrimidin-1-yl)-3,4-bis[(4-methylbenzoyl)oxy]-5-(phenylmethoxymethyl)oxolan-2-yl]methyl 4-methylbenzoate.
| Compound Name | [(2R,3R,4R,5R)-2-(4-benzamido-2-oxopyrimidin-1-yl)-3,4-bis[(4-methylbenzoyl)oxy]-5-(phenylmethoxymethyl)oxolan-2-yl]methyl 4-methylbenzoate |
|---|---|
| PubChem CID | 11629259 |
| Molecular Formula | C48H43N3O10 |
| Molecular Weight | 821.88 g/mol |
| Exact Mass | 821.29 |
| IUPAC Name | [(2R,3R,4R,5R)-2-(4-benzamido-2-oxopyrimidin-1-yl)-3,4-bis[(4-methylbenzoyl)oxy]-5-(phenylmethoxymethyl)oxolan-2-yl]methyl 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OC[C@@]2(n3ccc(NC(=O)c4ccccc4)nc3=O)O[C@H](COCc3ccccc3)[C@@H](OC(=O)c3ccc(C)cc3)[C@H]2OC(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C48H43N3O10/c1-31-14-20-36(21-15-31)44(53)58-30-48(51-27-26-40(50-47(51)56)49-43(52)35-12-8-5-9-13-35)42(60-46(55)38-24-18-33(3)19-25-38)41(59-45(54)37-22-16-32(2)17-23-37)39(61-48)29-57-28-34-10-6-4-7-11-34/h4-27,39,41-42H,28-30H2,1-3H3,(H,49,50,52,56)/t39-,41-,42-,48-/m1/s1 |
| InChIKey | RMZBAFSCEKQCEA-CWZLSXMYSA-N |
| XLogP | 7.00 |
| TPSA | 161.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.88 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|