About 5-methyl-1H-pyrrolo[3,2-b]pyridine
5-methyl-1H-pyrrolo[3,2-b]pyridine (PubChem CID 11629612) has the molecular formula C8H8N2
and a molecular weight of 132.17 g/mol. Its IUPAC name is 5-methyl-1H-pyrrolo[3,2-b]pyridine.
Molecular Properties
| Compound Name | 5-methyl-1H-pyrrolo[3,2-b]pyridine |
| PubChem CID | 11629612 |
| Molecular Formula | C8H8N2 |
| Molecular Weight | 132.17 g/mol |
| Exact Mass | 132.07 |
| IUPAC Name | 5-methyl-1H-pyrrolo[3,2-b]pyridine |
| SMILES | Cc1ccc2[nH]ccc2n1 |
| InChI | InChI=1S/C8H8N2/c1-6-2-3-7-8(10-6)4-5-9-7/h2-5,9H,1H3 |
| InChIKey | WGRRBPXKOSKCJO-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.17 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-methyl-1H-pyrrolo[3,2-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-1H-pyrrolo[3,2-b]pyridine?
The IUPAC name of 5-methyl-1H-pyrrolo[3,2-b]pyridine (CID 11629612) is 5-methyl-1H-pyrrolo[3,2-b]pyridine.
What is the SMILES notation for 5-methyl-1H-pyrrolo[3,2-b]pyridine?
The canonical SMILES for 5-methyl-1H-pyrrolo[3,2-b]pyridine is Cc1ccc2[nH]ccc2n1.
What is the InChIKey of 5-methyl-1H-pyrrolo[3,2-b]pyridine?
The InChIKey is WGRRBPXKOSKCJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2/c1-6-2-3-7-8(10-6)4-5-9-7/h2-5,9H,1H3.
What are the key properties of 5-methyl-1H-pyrrolo[3,2-b]pyridine?
5-methyl-1H-pyrrolo[3,2-b]pyridine has a molecular weight of 132.17 g/mol, XLogP of 1.87, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-1H-pyrrolo[3,2-b]pyridine is sourced from PubChem (CID 11629612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).