About 2-ethenyl-1,4-dimethoxybenzene
2-ethenyl-1,4-dimethoxybenzene (PubChem CID 11629652) has the molecular formula C10H12O2
and a molecular weight of 164.20 g/mol. Its IUPAC name is 2-ethenyl-1,4-dimethoxybenzene.
Molecular Properties
| Compound Name | 2-ethenyl-1,4-dimethoxybenzene |
| PubChem CID | 11629652 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 2-ethenyl-1,4-dimethoxybenzene |
| SMILES | C=Cc1cc(OC)ccc1OC |
| InChI | InChI=1S/C10H12O2/c1-4-8-7-9(11-2)5-6-10(8)12-3/h4-7H,1H2,2-3H3 |
| InChIKey | HBZNAZRMQALFLI-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethenyl-1,4-dimethoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenyl-1,4-dimethoxybenzene?
The IUPAC name of 2-ethenyl-1,4-dimethoxybenzene (CID 11629652) is 2-ethenyl-1,4-dimethoxybenzene.
What is the SMILES notation for 2-ethenyl-1,4-dimethoxybenzene?
The canonical SMILES for 2-ethenyl-1,4-dimethoxybenzene is C=Cc1cc(OC)ccc1OC.
What is the InChIKey of 2-ethenyl-1,4-dimethoxybenzene?
The InChIKey is HBZNAZRMQALFLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O2/c1-4-8-7-9(11-2)5-6-10(8)12-3/h4-7H,1H2,2-3H3.
What are the key properties of 2-ethenyl-1,4-dimethoxybenzene?
2-ethenyl-1,4-dimethoxybenzene has a molecular weight of 164.20 g/mol, XLogP of 2.35, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenyl-1,4-dimethoxybenzene is sourced from PubChem (CID 11629652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).