C9H20N2O — CID 11629669
2,2,6,6-tetramethyl-1-oxidopiperidin-1-ium-4-amine (PubChem CID 11629669) has the molecular formula C9H20N2O and a molecular weight of 172.27 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-1-oxidopiperidin-1-ium-4-amine.
| Compound Name | 2,2,6,6-tetramethyl-1-oxidopiperidin-1-ium-4-amine |
|---|---|
| PubChem CID | 11629669 |
| Molecular Formula | C9H20N2O |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.16 |
| IUPAC Name | 2,2,6,6-tetramethyl-1-oxidopiperidin-1-ium-4-amine |
| SMILES | CC1(C)CC(N)CC(C)(C)[NH+]1[O-] |
| InChI | InChI=1S/C9H20N2O/c1-8(2)5-7(10)6-9(3,4)11(8)12/h7,11H,5-6,10H2,1-4H3 |
| InChIKey | OJKKDSPQAAGKJR-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |