About 1,3-dimethoxy-1,3-dihydro-2-benzofuran
1,3-dimethoxy-1,3-dihydro-2-benzofuran (PubChem CID 11629690) has the molecular formula C10H12O3
and a molecular weight of 180.20 g/mol. Its IUPAC name is 1,3-dimethoxy-1,3-dihydro-2-benzofuran.
Molecular Properties
| Compound Name | 1,3-dimethoxy-1,3-dihydro-2-benzofuran |
| PubChem CID | 11629690 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 1,3-dimethoxy-1,3-dihydro-2-benzofuran |
| SMILES | COC1OC(OC)c2ccccc21 |
| InChI | InChI=1S/C10H12O3/c1-11-9-7-5-3-4-6-8(7)10(12-2)13-9/h3-6,9-10H,1-2H3 |
| InChIKey | WAGIYFLDSNLPML-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,3-dimethoxy-1,3-dihydro-2-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethoxy-1,3-dihydro-2-benzofuran?
The IUPAC name of 1,3-dimethoxy-1,3-dihydro-2-benzofuran (CID 11629690) is 1,3-dimethoxy-1,3-dihydro-2-benzofuran.
What is the SMILES notation for 1,3-dimethoxy-1,3-dihydro-2-benzofuran?
The canonical SMILES for 1,3-dimethoxy-1,3-dihydro-2-benzofuran is COC1OC(OC)c2ccccc21.
What is the InChIKey of 1,3-dimethoxy-1,3-dihydro-2-benzofuran?
The InChIKey is WAGIYFLDSNLPML-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O3/c1-11-9-7-5-3-4-6-8(7)10(12-2)13-9/h3-6,9-10H,1-2H3.
What are the key properties of 1,3-dimethoxy-1,3-dihydro-2-benzofuran?
1,3-dimethoxy-1,3-dihydro-2-benzofuran has a molecular weight of 180.20 g/mol, XLogP of 2.01, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethoxy-1,3-dihydro-2-benzofuran is sourced from PubChem (CID 11629690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).