3-amino-2-fluoro-5-methylhexane-1-sulfonic acid

C7H16FNO3S — CID 11629870

IUPAC3-amino-2-fluoro-5-methylhexane-1-sulfonic acid
SMILESCC(C)CC(N)C(F)CS(=O)(=O)O
InChIInChI=1S/C7H16FNO3S/c1-5(2)3-7(9)6(8)4-13(10,11)12/h5-7H,3-4,9H2,1-2H3,(H,10,11,12)
InChIKeyBDCXXBZPNQXMMC-UHFFFAOYSA-N
MW213.27 g/mol
LogP0.59
Rot. Bonds5

About 3-amino-2-fluoro-5-methylhexane-1-sulfonic acid

3-amino-2-fluoro-5-methylhexane-1-sulfonic acid (PubChem CID 11629870) has the molecular formula C7H16FNO3S and a molecular weight of 213.27 g/mol. Its IUPAC name is 3-amino-2-fluoro-5-methylhexane-1-sulfonic acid.

Molecular Properties

Compound Name3-amino-2-fluoro-5-methylhexane-1-sulfonic acid
PubChem CID11629870
Molecular FormulaC7H16FNO3S
Molecular Weight213.27 g/mol
Exact Mass213.08
IUPAC Name3-amino-2-fluoro-5-methylhexane-1-sulfonic acid
SMILESCC(C)CC(N)C(F)CS(=O)(=O)O
InChIInChI=1S/C7H16FNO3S/c1-5(2)3-7(9)6(8)4-13(10,11)12/h5-7H,3-4,9H2,1-2H3,(H,10,11,12)
InChIKeyBDCXXBZPNQXMMC-UHFFFAOYSA-N
XLogP0.59
TPSA80.39 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500213.27
LogP ≤ 50.59
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 3-amino-2-fluoro-5-methylhexane-1-sulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

(3R)-3-amino-2,2-difluoro-5-methylhexane-1-sulfonic acid
CID 11499607
3-Amino-2,2-difluoro-5-methylhexane-1-sulfonic acid
CID 11528746
(3S)-3-amino-1,1-difluoro-5-methylhexane-1-sulfonic acid
CID 11535964
(3R)-3-amino-2-fluoro-5-methylhexane-1-sulfonic acid
CID 11550269
(2R,3R)-3-amino-2-fluoro-5-methylhexane-1-sulfonic acid
CID 11550270
(2R)-3-amino-2-fluoro-5-methylhexane-1-sulfonic acid
CID 11586544
(3S)-3-amino-2-fluoro-5-methylhexane-1-sulfonic acid
CID 11593718
(2S)-3-amino-2-fluoro-5-methylhexane-1-sulfonic acid
CID 11622600
(3R)-3-amino-1,1-difluoro-5-methylhexane-1-sulfonic acid
CID 11622750
(2R,3S)-3-amino-2-fluoro-5-methylhexane-1-sulfonic acid
CID 11637096
3-Amino-1,1-difluoro-5-methylhexane-1-sulfonic acid
CID 11644315
(2S,3R)-3-amino-2-fluoro-5-methylhexane-1-sulfonic acid
CID 11708314

Frequently Asked Questions

What is the IUPAC name of 3-amino-2-fluoro-5-methylhexane-1-sulfonic acid?
The IUPAC name of 3-amino-2-fluoro-5-methylhexane-1-sulfonic acid (CID 11629870) is 3-amino-2-fluoro-5-methylhexane-1-sulfonic acid.
What is the SMILES notation for 3-amino-2-fluoro-5-methylhexane-1-sulfonic acid?
The canonical SMILES for 3-amino-2-fluoro-5-methylhexane-1-sulfonic acid is CC(C)CC(N)C(F)CS(=O)(=O)O.
What is the InChIKey of 3-amino-2-fluoro-5-methylhexane-1-sulfonic acid?
The InChIKey is BDCXXBZPNQXMMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16FNO3S/c1-5(2)3-7(9)6(8)4-13(10,11)12/h5-7H,3-4,9H2,1-2H3,(H,10,11,12).
What are the key properties of 3-amino-2-fluoro-5-methylhexane-1-sulfonic acid?
3-amino-2-fluoro-5-methylhexane-1-sulfonic acid has a molecular weight of 213.27 g/mol, XLogP of 0.59, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2-fluoro-5-methylhexane-1-sulfonic acid is sourced from PubChem (CID 11629870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).