(2S,4R)-2-amino-4-(3-methylbutyl)pentanedioic acid

C10H19NO4 — CID 11629898

IUPAC(2S,4R)-2-amino-4-(3-methylbutyl)pentanedioic acid
SMILESCC(C)CC[C@H](C[C@H](N)C(=O)O)C(=O)O
InChIInChI=1S/C10H19NO4/c1-6(2)3-4-7(9(12)13)5-8(11)10(14)15/h6-8H,3-5,11H2,1-2H3,(H,12,13)(H,14,15)/t7-,8+/m1/s1
InChIKeySBLWSMSFRMKPMN-SFYZADRCSA-N
MW217.26 g/mol
LogP0.93
Rot. Bonds7

About (2S,4R)-2-amino-4-(3-methylbutyl)pentanedioic acid

(2S,4R)-2-amino-4-(3-methylbutyl)pentanedioic acid (PubChem CID 11629898) has the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. Its IUPAC name is (2S,4R)-2-amino-4-(3-methylbutyl)pentanedioic acid.

Molecular Properties

Compound Name(2S,4R)-2-amino-4-(3-methylbutyl)pentanedioic acid
PubChem CID11629898
Molecular FormulaC10H19NO4
Molecular Weight217.26 g/mol
Exact Mass217.13
IUPAC Name(2S,4R)-2-amino-4-(3-methylbutyl)pentanedioic acid
SMILESCC(C)CC[C@H](C[C@H](N)C(=O)O)C(=O)O
InChIInChI=1S/C10H19NO4/c1-6(2)3-4-7(9(12)13)5-8(11)10(14)15/h6-8H,3-5,11H2,1-2H3,(H,12,13)(H,14,15)/t7-,8+/m1/s1
InChIKeySBLWSMSFRMKPMN-SFYZADRCSA-N
XLogP0.93
TPSA100.62 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500217.26
LogP ≤ 50.93
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze (2S,4R)-2-amino-4-(3-methylbutyl)pentanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S,4R)-2-amino-4-(3-methylbutyl)pentanedioic acid?
The IUPAC name of (2S,4R)-2-amino-4-(3-methylbutyl)pentanedioic acid (CID 11629898) is (2S,4R)-2-amino-4-(3-methylbutyl)pentanedioic acid.
What is the SMILES notation for (2S,4R)-2-amino-4-(3-methylbutyl)pentanedioic acid?
The canonical SMILES for (2S,4R)-2-amino-4-(3-methylbutyl)pentanedioic acid is CC(C)CC[C@H](C[C@H](N)C(=O)O)C(=O)O.
What is the InChIKey of (2S,4R)-2-amino-4-(3-methylbutyl)pentanedioic acid?
The InChIKey is SBLWSMSFRMKPMN-SFYZADRCSA-N. The full InChI is InChI=1S/C10H19NO4/c1-6(2)3-4-7(9(12)13)5-8(11)10(14)15/h6-8H,3-5,11H2,1-2H3,(H,12,13)(H,14,15)/t7-,8+/m1/s1.
What are the key properties of (2S,4R)-2-amino-4-(3-methylbutyl)pentanedioic acid?
(2S,4R)-2-amino-4-(3-methylbutyl)pentanedioic acid has a molecular weight of 217.26 g/mol, XLogP of 0.93, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,4R)-2-amino-4-(3-methylbutyl)pentanedioic acid is sourced from PubChem (CID 11629898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).