About 4-methoxy-[1,2]thiazolo[5,4-b]indol-6-ol
4-methoxy-[1,2]thiazolo[5,4-b]indol-6-ol (PubChem CID 11629917) has the molecular formula C10H8N2O2S
and a molecular weight of 220.25 g/mol. Its IUPAC name is 4-methoxy-[1,2]thiazolo[5,4-b]indol-6-ol.
Molecular Properties
| Compound Name | 4-methoxy-[1,2]thiazolo[5,4-b]indol-6-ol |
| PubChem CID | 11629917 |
| Molecular Formula | C10H8N2O2S |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.03 |
| IUPAC Name | 4-methoxy-[1,2]thiazolo[5,4-b]indol-6-ol |
| SMILES | COn1c2cc(O)ccc2c2cnsc21 |
| InChI | InChI=1S/C10H8N2O2S/c1-14-12-9-4-6(13)2-3-7(9)8-5-11-15-10(8)12/h2-5,13H,1H3 |
| InChIKey | OBKCAGAWPAKBOI-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-methoxy-[1,2]thiazolo[5,4-b]indol-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-[1,2]thiazolo[5,4-b]indol-6-ol?
The IUPAC name of 4-methoxy-[1,2]thiazolo[5,4-b]indol-6-ol (CID 11629917) is 4-methoxy-[1,2]thiazolo[5,4-b]indol-6-ol.
What is the SMILES notation for 4-methoxy-[1,2]thiazolo[5,4-b]indol-6-ol?
The canonical SMILES for 4-methoxy-[1,2]thiazolo[5,4-b]indol-6-ol is COn1c2cc(O)ccc2c2cnsc21.
What is the InChIKey of 4-methoxy-[1,2]thiazolo[5,4-b]indol-6-ol?
The InChIKey is OBKCAGAWPAKBOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O2S/c1-14-12-9-4-6(13)2-3-7(9)8-5-11-15-10(8)12/h2-5,13H,1H3.
What are the key properties of 4-methoxy-[1,2]thiazolo[5,4-b]indol-6-ol?
4-methoxy-[1,2]thiazolo[5,4-b]indol-6-ol has a molecular weight of 220.25 g/mol, XLogP of 2.02, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-[1,2]thiazolo[5,4-b]indol-6-ol is sourced from PubChem (CID 11629917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).