C11H12O5 — CID 11629952
(1R,4S)-3-methoxycarbonyl-1,4-dimethyl-7-oxabicyclo[2.2.1]hepta-2,5-diene-2-carboxylic acid (PubChem CID 11629952) has the molecular formula C11H12O5 and a molecular weight of 224.21 g/mol. Its IUPAC name is (1R,4S)-3-methoxycarbonyl-1,4-dimethyl-7-oxabicyclo[2.2.1]hepta-2,5-diene-2-carboxylic acid.
| Compound Name | (1R,4S)-3-methoxycarbonyl-1,4-dimethyl-7-oxabicyclo[2.2.1]hepta-2,5-diene-2-carboxylic acid |
|---|---|
| PubChem CID | 11629952 |
| Molecular Formula | C11H12O5 |
| Molecular Weight | 224.21 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | (1R,4S)-3-methoxycarbonyl-1,4-dimethyl-7-oxabicyclo[2.2.1]hepta-2,5-diene-2-carboxylic acid |
| SMILES | COC(=O)C1=C(C(=O)O)[C@@]2(C)C=C[C@]1(C)O2 |
| InChI | InChI=1S/C11H12O5/c1-10-4-5-11(2,16-10)7(9(14)15-3)6(10)8(12)13/h4-5H,1-3H3,(H,12,13)/t10-,11+/m1/s1 |
| InChIKey | UCKCUURLVPHPCF-MNOVXSKESA-N |
| XLogP | 0.66 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.21 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|