C17H26O — CID 11630151
(1R,2R,4S,5R,6R,7S)-5-butyl-4-propyltricyclo[5.2.1.02,6]dec-8-en-3-one (PubChem CID 11630151) has the molecular formula C17H26O and a molecular weight of 246.39 g/mol. Its IUPAC name is (1R,2R,4S,5R,6R,7S)-5-butyl-4-propyltricyclo[5.2.1.02,6]dec-8-en-3-one.
| Compound Name | (1R,2R,4S,5R,6R,7S)-5-butyl-4-propyltricyclo[5.2.1.02,6]dec-8-en-3-one |
|---|---|
| PubChem CID | 11630151 |
| Molecular Formula | C17H26O |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | (1R,2R,4S,5R,6R,7S)-5-butyl-4-propyltricyclo[5.2.1.02,6]dec-8-en-3-one |
| SMILES | CCCC[C@@H]1[C@@H]2[C@H](C(=O)[C@H]1CCC)[C@H]1C=C[C@@H]2C1 |
| InChI | InChI=1S/C17H26O/c1-3-5-7-13-14(6-4-2)17(18)16-12-9-8-11(10-12)15(13)16/h8-9,11-16H,3-7,10H2,1-2H3/t11-,12+,13+,14+,15-,16-/m1/s1 |
| InChIKey | RQLKPKMXFQWUDL-FOLNQXHWSA-N |
| XLogP | 4.23 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|