C13H16ClN3O — CID 11630354
(5aR)-10-chloro-8-methyl-2,3,4,5,5a,6-hexahydro-1H-[1,4]diazepino[1,7-a]quinazolin-7-one (PubChem CID 11630354) has the molecular formula C13H16ClN3O and a molecular weight of 265.74 g/mol. Its IUPAC name is (5aR)-10-chloro-8-methyl-2,3,4,5,5a,6-hexahydro-1H-[1,4]diazepino[1,7-a]quinazolin-7-one.
| Compound Name | (5aR)-10-chloro-8-methyl-2,3,4,5,5a,6-hexahydro-1H-[1,4]diazepino[1,7-a]quinazolin-7-one |
|---|---|
| PubChem CID | 11630354 |
| Molecular Formula | C13H16ClN3O |
| Molecular Weight | 265.74 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | (5aR)-10-chloro-8-methyl-2,3,4,5,5a,6-hexahydro-1H-[1,4]diazepino[1,7-a]quinazolin-7-one |
| SMILES | Cc1cc(Cl)cc2c1C(=O)N[C@H]1CCNCCN21 |
| InChI | InChI=1S/C13H16ClN3O/c1-8-6-9(14)7-10-12(8)13(18)16-11-2-3-15-4-5-17(10)11/h6-7,11,15H,2-5H2,1H3,(H,16,18)/t11-/m1/s1 |
| InChIKey | KKNPAWRXWWAWHG-LLVKDONJSA-N |
| XLogP | 1.52 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.74 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |