About pent-4-enyl 4-sulfamoylbenzoate
pent-4-enyl 4-sulfamoylbenzoate (PubChem CID 11630396) has the molecular formula C12H15NO4S
and a molecular weight of 269.32 g/mol. Its IUPAC name is pent-4-enyl 4-sulfamoylbenzoate.
Molecular Properties
| Compound Name | pent-4-enyl 4-sulfamoylbenzoate |
| PubChem CID | 11630396 |
| Molecular Formula | C12H15NO4S |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | pent-4-enyl 4-sulfamoylbenzoate |
| SMILES | C=CCCCOC(=O)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C12H15NO4S/c1-2-3-4-9-17-12(14)10-5-7-11(8-6-10)18(13,15)16/h2,5-8H,1,3-4,9H2,(H2,13,15,16) |
| InChIKey | IEMQKTRDDVFPKZ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze pent-4-enyl 4-sulfamoylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pent-4-enyl 4-sulfamoylbenzoate?
The IUPAC name of pent-4-enyl 4-sulfamoylbenzoate (CID 11630396) is pent-4-enyl 4-sulfamoylbenzoate.
What is the SMILES notation for pent-4-enyl 4-sulfamoylbenzoate?
The canonical SMILES for pent-4-enyl 4-sulfamoylbenzoate is C=CCCCOC(=O)c1ccc(S(N)(=O)=O)cc1.
What is the InChIKey of pent-4-enyl 4-sulfamoylbenzoate?
The InChIKey is IEMQKTRDDVFPKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO4S/c1-2-3-4-9-17-12(14)10-5-7-11(8-6-10)18(13,15)16/h2,5-8H,1,3-4,9H2,(H2,13,15,16).
What are the key properties of pent-4-enyl 4-sulfamoylbenzoate?
pent-4-enyl 4-sulfamoylbenzoate has a molecular weight of 269.32 g/mol, XLogP of 1.46, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pent-4-enyl 4-sulfamoylbenzoate is sourced from PubChem (CID 11630396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).