C17H21NO2 — CID 11630418
4-[2-[(3,5-dimethylphenyl)methylamino]-1-hydroxyethyl]phenol (PubChem CID 11630418) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is 4-[2-[(3,5-dimethylphenyl)methylamino]-1-hydroxyethyl]phenol.
| Compound Name | 4-[2-[(3,5-dimethylphenyl)methylamino]-1-hydroxyethyl]phenol |
|---|---|
| PubChem CID | 11630418 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | 4-[2-[(3,5-dimethylphenyl)methylamino]-1-hydroxyethyl]phenol |
| SMILES | Cc1cc(C)cc(CNCC(O)c2ccc(O)cc2)c1 |
| InChI | InChI=1S/C17H21NO2/c1-12-7-13(2)9-14(8-12)10-18-11-17(20)15-3-5-16(19)6-4-15/h3-9,17-20H,10-11H2,1-2H3 |
| InChIKey | LFVJXGJXRMFILV-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |