C16H19NO5 — CID 11630877
3-[3-(2-carboxyethyl)-1-ethyl-2-oxoindol-3-yl]propanoic acid (PubChem CID 11630877) has the molecular formula C16H19NO5 and a molecular weight of 305.33 g/mol. Its IUPAC name is 3-[3-(2-carboxyethyl)-1-ethyl-2-oxoindol-3-yl]propanoic acid.
| Compound Name | 3-[3-(2-carboxyethyl)-1-ethyl-2-oxoindol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 11630877 |
| Molecular Formula | C16H19NO5 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 3-[3-(2-carboxyethyl)-1-ethyl-2-oxoindol-3-yl]propanoic acid |
| SMILES | CCN1C(=O)C(CCC(=O)O)(CCC(=O)O)c2ccccc21 |
| InChI | InChI=1S/C16H19NO5/c1-2-17-12-6-4-3-5-11(12)16(15(17)22,9-7-13(18)19)10-8-14(20)21/h3-6H,2,7-10H2,1H3,(H,18,19)(H,20,21) |
| InChIKey | YGKNNOQNZZTLPS-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |