About 3-[[1-(2,3-dichlorophenyl)tetrazol-5-yl]methyl]pyridine
3-[[1-(2,3-dichlorophenyl)tetrazol-5-yl]methyl]pyridine (PubChem CID 11630893) has the molecular formula C13H9Cl2N5
and a molecular weight of 306.16 g/mol. Its IUPAC name is 3-[[1-(2,3-dichlorophenyl)tetrazol-5-yl]methyl]pyridine.
Molecular Properties
| Compound Name | 3-[[1-(2,3-dichlorophenyl)tetrazol-5-yl]methyl]pyridine |
| PubChem CID | 11630893 |
| Molecular Formula | C13H9Cl2N5 |
| Molecular Weight | 306.16 g/mol |
| Exact Mass | 305.02 |
| IUPAC Name | 3-[[1-(2,3-dichlorophenyl)tetrazol-5-yl]methyl]pyridine |
| SMILES | Clc1cccc(-n2nnnc2Cc2cccnc2)c1Cl |
| InChI | InChI=1S/C13H9Cl2N5/c14-10-4-1-5-11(13(10)15)20-12(17-18-19-20)7-9-3-2-6-16-8-9/h1-6,8H,7H2 |
| InChIKey | IJLSAUVIDVEOME-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.16 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[[1-(2,3-dichlorophenyl)tetrazol-5-yl]methyl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[1-(2,3-dichlorophenyl)tetrazol-5-yl]methyl]pyridine?
The IUPAC name of 3-[[1-(2,3-dichlorophenyl)tetrazol-5-yl]methyl]pyridine (CID 11630893) is 3-[[1-(2,3-dichlorophenyl)tetrazol-5-yl]methyl]pyridine.
What is the SMILES notation for 3-[[1-(2,3-dichlorophenyl)tetrazol-5-yl]methyl]pyridine?
The canonical SMILES for 3-[[1-(2,3-dichlorophenyl)tetrazol-5-yl]methyl]pyridine is Clc1cccc(-n2nnnc2Cc2cccnc2)c1Cl.
What is the InChIKey of 3-[[1-(2,3-dichlorophenyl)tetrazol-5-yl]methyl]pyridine?
The InChIKey is IJLSAUVIDVEOME-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9Cl2N5/c14-10-4-1-5-11(13(10)15)20-12(17-18-19-20)7-9-3-2-6-16-8-9/h1-6,8H,7H2.
What are the key properties of 3-[[1-(2,3-dichlorophenyl)tetrazol-5-yl]methyl]pyridine?
3-[[1-(2,3-dichlorophenyl)tetrazol-5-yl]methyl]pyridine has a molecular weight of 306.16 g/mol, XLogP of 2.95, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[1-(2,3-dichlorophenyl)tetrazol-5-yl]methyl]pyridine is sourced from PubChem (CID 11630893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).