C18H28O2S — CID 11630936
3-[(2E)-3,7-dimethylocta-2,6-dienyl]-5-methyl-3-propylthiolane-2,4-dione (PubChem CID 11630936) has the molecular formula C18H28O2S and a molecular weight of 308.49 g/mol. Its IUPAC name is 3-[(2E)-3,7-dimethylocta-2,6-dienyl]-5-methyl-3-propylthiolane-2,4-dione.
| Compound Name | 3-[(2E)-3,7-dimethylocta-2,6-dienyl]-5-methyl-3-propylthiolane-2,4-dione |
|---|---|
| PubChem CID | 11630936 |
| Molecular Formula | C18H28O2S |
| Molecular Weight | 308.49 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | 3-[(2E)-3,7-dimethylocta-2,6-dienyl]-5-methyl-3-propylthiolane-2,4-dione |
| SMILES | CCCC1(C/C=C(\C)CCC=C(C)C)C(=O)SC(C)C1=O |
| InChI | InChI=1S/C18H28O2S/c1-6-11-18(16(19)15(5)21-17(18)20)12-10-14(4)9-7-8-13(2)3/h8,10,15H,6-7,9,11-12H2,1-5H3/b14-10+ |
| InChIKey | WHJWSLKITRRSGJ-GXDHUFHOSA-N |
| XLogP | 5.09 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.49 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|