C15H13ClO5 — CID 11630937
[(2E,3S,4R,5S,9R)-3-chloro-2-hexa-2,4-diynylidene-4-hydroxy-1,6-dioxaspiro[4.4]non-7-en-9-yl] acetate (PubChem CID 11630937) has the molecular formula C15H13ClO5 and a molecular weight of 308.72 g/mol. Its IUPAC name is [(2E,3S,4R,5S,9R)-3-chloro-2-hexa-2,4-diynylidene-4-hydroxy-1,6-dioxaspiro[4.4]non-7-en-9-yl] acetate.
| Compound Name | [(2E,3S,4R,5S,9R)-3-chloro-2-hexa-2,4-diynylidene-4-hydroxy-1,6-dioxaspiro[4.4]non-7-en-9-yl] acetate |
|---|---|
| PubChem CID | 11630937 |
| Molecular Formula | C15H13ClO5 |
| Molecular Weight | 308.72 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | [(2E,3S,4R,5S,9R)-3-chloro-2-hexa-2,4-diynylidene-4-hydroxy-1,6-dioxaspiro[4.4]non-7-en-9-yl] acetate |
| SMILES | CC#CC#C/C=C1/O[C@@]2(OC=C[C@H]2OC(C)=O)[C@@H](O)[C@@H]1Cl |
| InChI | InChI=1S/C15H13ClO5/c1-3-4-5-6-7-11-13(16)14(18)15(21-11)12(8-9-19-15)20-10(2)17/h7-9,12-14,18H,1-2H3/b11-7+/t12-,13-,14+,15-/m1/s1 |
| InChIKey | OMTKEJWBQVTEHK-ZLGGFXMGSA-N |
| XLogP | 1.07 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.72 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|