About ethyl (Z)-6-hydroxy-2,2,4-trimethyl-3-triethylsilyloxyhex-4-enoate
ethyl (Z)-6-hydroxy-2,2,4-trimethyl-3-triethylsilyloxyhex-4-enoate (PubChem CID 11631306) has the molecular formula C17H34O4Si
and a molecular weight of 330.54 g/mol. Its IUPAC name is ethyl (Z)-6-hydroxy-2,2,4-trimethyl-3-triethylsilyloxyhex-4-enoate.
Molecular Properties
| Compound Name | ethyl (Z)-6-hydroxy-2,2,4-trimethyl-3-triethylsilyloxyhex-4-enoate |
| PubChem CID | 11631306 |
| Molecular Formula | C17H34O4Si |
| Molecular Weight | 330.54 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | ethyl (Z)-6-hydroxy-2,2,4-trimethyl-3-triethylsilyloxyhex-4-enoate |
| SMILES | CCOC(=O)C(C)(C)C(O[Si](CC)(CC)CC)/C(C)=C\CO |
| InChI | InChI=1S/C17H34O4Si/c1-8-20-16(19)17(6,7)15(14(5)12-13-18)21-22(9-2,10-3)11-4/h12,15,18H,8-11,13H2,1-7H3/b14-12- |
| InChIKey | SMYKMQAFZHLEKP-OWBHPGMISA-N |
| XLogP | 3.90 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.54 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl (Z)-6-hydroxy-2,2,4-trimethyl-3-triethylsilyloxyhex-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (Z)-6-hydroxy-2,2,4-trimethyl-3-triethylsilyloxyhex-4-enoate?
The IUPAC name of ethyl (Z)-6-hydroxy-2,2,4-trimethyl-3-triethylsilyloxyhex-4-enoate (CID 11631306) is ethyl (Z)-6-hydroxy-2,2,4-trimethyl-3-triethylsilyloxyhex-4-enoate.
What is the SMILES notation for ethyl (Z)-6-hydroxy-2,2,4-trimethyl-3-triethylsilyloxyhex-4-enoate?
The canonical SMILES for ethyl (Z)-6-hydroxy-2,2,4-trimethyl-3-triethylsilyloxyhex-4-enoate is CCOC(=O)C(C)(C)C(O[Si](CC)(CC)CC)/C(C)=C\CO.
What is the InChIKey of ethyl (Z)-6-hydroxy-2,2,4-trimethyl-3-triethylsilyloxyhex-4-enoate?
The InChIKey is SMYKMQAFZHLEKP-OWBHPGMISA-N. The full InChI is InChI=1S/C17H34O4Si/c1-8-20-16(19)17(6,7)15(14(5)12-13-18)21-22(9-2,10-3)11-4/h12,15,18H,8-11,13H2,1-7H3/b14-12-.
What are the key properties of ethyl (Z)-6-hydroxy-2,2,4-trimethyl-3-triethylsilyloxyhex-4-enoate?
ethyl (Z)-6-hydroxy-2,2,4-trimethyl-3-triethylsilyloxyhex-4-enoate has a molecular weight of 330.54 g/mol, XLogP of 3.90, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (Z)-6-hydroxy-2,2,4-trimethyl-3-triethylsilyloxyhex-4-enoate is sourced from PubChem (CID 11631306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).