C19H28N2O3 — CID 11631338
2-[[1-[(6-ethyl-2-pyridinyl)carbamoyl]cyclopentyl]methyl]pentanoic acid (PubChem CID 11631338) has the molecular formula C19H28N2O3 and a molecular weight of 332.44 g/mol. Its IUPAC name is 2-[[1-[(6-ethyl-2-pyridinyl)carbamoyl]cyclopentyl]methyl]pentanoic acid.
| Compound Name | 2-[[1-[(6-ethyl-2-pyridinyl)carbamoyl]cyclopentyl]methyl]pentanoic acid |
|---|---|
| PubChem CID | 11631338 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | 2-[[1-[(6-ethyl-2-pyridinyl)carbamoyl]cyclopentyl]methyl]pentanoic acid |
| SMILES | CCCC(CC1(C(=O)Nc2cccc(CC)n2)CCCC1)C(=O)O |
| InChI | InChI=1S/C19H28N2O3/c1-3-8-14(17(22)23)13-19(11-5-6-12-19)18(24)21-16-10-7-9-15(4-2)20-16/h7,9-10,14H,3-6,8,11-13H2,1-2H3,(H,22,23)(H,20,21,24) |
| InChIKey | XQGIVVYXGDZTKU-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |