C12H8F4N2O3S — CID 11631403
2-[4-methyl-2-(2,3,4,5-tetrafluorophenyl)-1,3-thiazol-5-yl]ethyl nitrate (PubChem CID 11631403) has the molecular formula C12H8F4N2O3S and a molecular weight of 336.27 g/mol. Its IUPAC name is 2-[4-methyl-2-(2,3,4,5-tetrafluorophenyl)-1,3-thiazol-5-yl]ethyl nitrate.
| Compound Name | 2-[4-methyl-2-(2,3,4,5-tetrafluorophenyl)-1,3-thiazol-5-yl]ethyl nitrate |
|---|---|
| PubChem CID | 11631403 |
| Molecular Formula | C12H8F4N2O3S |
| Molecular Weight | 336.27 g/mol |
| Exact Mass | 336.02 |
| IUPAC Name | 2-[4-methyl-2-(2,3,4,5-tetrafluorophenyl)-1,3-thiazol-5-yl]ethyl nitrate |
| SMILES | Cc1nc(-c2cc(F)c(F)c(F)c2F)sc1CCO[N+](=O)[O-] |
| InChI | InChI=1S/C12H8F4N2O3S/c1-5-8(2-3-21-18(19)20)22-12(17-5)6-4-7(13)10(15)11(16)9(6)14/h4H,2-3H2,1H3 |
| InChIKey | CAHVHIBJIVVFBY-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 65.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.27 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|