C19H34O3Si — CID 11631456
(3Z,6S,8S,9E)-7,7-dimethyl-8-(2-trimethylsilylethoxymethoxy)undeca-3,9-dien-1-yn-6-ol (PubChem CID 11631456) has the molecular formula C19H34O3Si and a molecular weight of 338.56 g/mol. Its IUPAC name is (3Z,6S,8S,9E)-7,7-dimethyl-8-(2-trimethylsilylethoxymethoxy)undeca-3,9-dien-1-yn-6-ol.
| Compound Name | (3Z,6S,8S,9E)-7,7-dimethyl-8-(2-trimethylsilylethoxymethoxy)undeca-3,9-dien-1-yn-6-ol |
|---|---|
| PubChem CID | 11631456 |
| Molecular Formula | C19H34O3Si |
| Molecular Weight | 338.56 g/mol |
| Exact Mass | 338.23 |
| IUPAC Name | (3Z,6S,8S,9E)-7,7-dimethyl-8-(2-trimethylsilylethoxymethoxy)undeca-3,9-dien-1-yn-6-ol |
| SMILES | C#C/C=C\C[C@H](O)C(C)(C)[C@H](/C=C/C)OCOCC[Si](C)(C)C |
| InChI | InChI=1S/C19H34O3Si/c1-8-10-11-13-17(20)19(3,4)18(12-9-2)22-16-21-14-15-23(5,6)7/h1,9-12,17-18,20H,13-16H2,2-7H3/b11-10-,12-9+/t17-,18-/m0/s1 |
| InChIKey | MXXFODNVOCWZBA-DSLRBPKUSA-N |
| XLogP | 4.23 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.56 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|