About 4-(5-fluoro-2-methylphenyl)-1-furo[2,3-c]pyridin-2-yl-2,4-dimethylpentan-2-ol
4-(5-fluoro-2-methylphenyl)-1-furo[2,3-c]pyridin-2-yl-2,4-dimethylpentan-2-ol (PubChem CID 11631492) has the molecular formula C21H24FNO2
and a molecular weight of 341.43 g/mol. Its IUPAC name is 4-(5-fluoro-2-methylphenyl)-1-furo[2,3-c]pyridin-2-yl-2,4-dimethylpentan-2-ol.
Molecular Properties
| Compound Name | 4-(5-fluoro-2-methylphenyl)-1-furo[2,3-c]pyridin-2-yl-2,4-dimethylpentan-2-ol |
| PubChem CID | 11631492 |
| Molecular Formula | C21H24FNO2 |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | 4-(5-fluoro-2-methylphenyl)-1-furo[2,3-c]pyridin-2-yl-2,4-dimethylpentan-2-ol |
| SMILES | Cc1ccc(F)cc1C(C)(C)CC(C)(O)Cc1cc2ccncc2o1 |
| InChI | InChI=1S/C21H24FNO2/c1-14-5-6-16(22)10-18(14)20(2,3)13-21(4,24)11-17-9-15-7-8-23-12-19(15)25-17/h5-10,12,24H,11,13H2,1-4H3 |
| InChIKey | IJHGAALYVHDVRO-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(5-fluoro-2-methylphenyl)-1-furo[2,3-c]pyridin-2-yl-2,4-dimethylpentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-fluoro-2-methylphenyl)-1-furo[2,3-c]pyridin-2-yl-2,4-dimethylpentan-2-ol?
The IUPAC name of 4-(5-fluoro-2-methylphenyl)-1-furo[2,3-c]pyridin-2-yl-2,4-dimethylpentan-2-ol (CID 11631492) is 4-(5-fluoro-2-methylphenyl)-1-furo[2,3-c]pyridin-2-yl-2,4-dimethylpentan-2-ol.
What is the SMILES notation for 4-(5-fluoro-2-methylphenyl)-1-furo[2,3-c]pyridin-2-yl-2,4-dimethylpentan-2-ol?
The canonical SMILES for 4-(5-fluoro-2-methylphenyl)-1-furo[2,3-c]pyridin-2-yl-2,4-dimethylpentan-2-ol is Cc1ccc(F)cc1C(C)(C)CC(C)(O)Cc1cc2ccncc2o1.
What is the InChIKey of 4-(5-fluoro-2-methylphenyl)-1-furo[2,3-c]pyridin-2-yl-2,4-dimethylpentan-2-ol?
The InChIKey is IJHGAALYVHDVRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24FNO2/c1-14-5-6-16(22)10-18(14)20(2,3)13-21(4,24)11-17-9-15-7-8-23-12-19(15)25-17/h5-10,12,24H,11,13H2,1-4H3.
What are the key properties of 4-(5-fluoro-2-methylphenyl)-1-furo[2,3-c]pyridin-2-yl-2,4-dimethylpentan-2-ol?
4-(5-fluoro-2-methylphenyl)-1-furo[2,3-c]pyridin-2-yl-2,4-dimethylpentan-2-ol has a molecular weight of 341.43 g/mol, XLogP of 4.94, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-fluoro-2-methylphenyl)-1-furo[2,3-c]pyridin-2-yl-2,4-dimethylpentan-2-ol is sourced from PubChem (CID 11631492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).