About 5,7-dihydroindolo[2,3-b]carbazol-6-yl ethyl carbonate
5,7-dihydroindolo[2,3-b]carbazol-6-yl ethyl carbonate (PubChem CID 11631548) has the molecular formula C21H16N2O3
and a molecular weight of 344.37 g/mol. Its IUPAC name is 5,7-dihydroindolo[2,3-b]carbazol-6-yl ethyl carbonate.
Molecular Properties
| Compound Name | 5,7-dihydroindolo[2,3-b]carbazol-6-yl ethyl carbonate |
| PubChem CID | 11631548 |
| Molecular Formula | C21H16N2O3 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 5,7-dihydroindolo[2,3-b]carbazol-6-yl ethyl carbonate |
| SMILES | CCOC(=O)Oc1c2[nH]c3ccccc3c2cc2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C21H16N2O3/c1-2-25-21(24)26-20-18-14(12-7-3-5-9-16(12)22-18)11-15-13-8-4-6-10-17(13)23-19(15)20/h3-11,22-23H,2H2,1H3 |
| InChIKey | HHLRSANYYAEVCV-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 67.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze 5,7-dihydroindolo[2,3-b]carbazol-6-yl ethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dihydroindolo[2,3-b]carbazol-6-yl ethyl carbonate?
The IUPAC name of 5,7-dihydroindolo[2,3-b]carbazol-6-yl ethyl carbonate (CID 11631548) is 5,7-dihydroindolo[2,3-b]carbazol-6-yl ethyl carbonate.
What is the SMILES notation for 5,7-dihydroindolo[2,3-b]carbazol-6-yl ethyl carbonate?
The canonical SMILES for 5,7-dihydroindolo[2,3-b]carbazol-6-yl ethyl carbonate is CCOC(=O)Oc1c2[nH]c3ccccc3c2cc2c1[nH]c1ccccc12.
What is the InChIKey of 5,7-dihydroindolo[2,3-b]carbazol-6-yl ethyl carbonate?
The InChIKey is HHLRSANYYAEVCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16N2O3/c1-2-25-21(24)26-20-18-14(12-7-3-5-9-16(12)22-18)11-15-13-8-4-6-10-17(13)23-19(15)20/h3-11,22-23H,2H2,1H3.
What are the key properties of 5,7-dihydroindolo[2,3-b]carbazol-6-yl ethyl carbonate?
5,7-dihydroindolo[2,3-b]carbazol-6-yl ethyl carbonate has a molecular weight of 344.37 g/mol, XLogP of 5.49, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dihydroindolo[2,3-b]carbazol-6-yl ethyl carbonate is sourced from PubChem (CID 11631548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).