About 1-ethyl-4,6-bis[(E)-prop-1-enyl]-3,5-bis(trimethylsilyl)pyridin-2-one
1-ethyl-4,6-bis[(E)-prop-1-enyl]-3,5-bis(trimethylsilyl)pyridin-2-one (PubChem CID 11631619) has the molecular formula C19H33NOSi2
and a molecular weight of 347.65 g/mol. Its IUPAC name is 1-ethyl-4,6-bis[(E)-prop-1-enyl]-3,5-bis(trimethylsilyl)pyridin-2-one.
Molecular Properties
| Compound Name | 1-ethyl-4,6-bis[(E)-prop-1-enyl]-3,5-bis(trimethylsilyl)pyridin-2-one |
| PubChem CID | 11631619 |
| Molecular Formula | C19H33NOSi2 |
| Molecular Weight | 347.65 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | 1-ethyl-4,6-bis[(E)-prop-1-enyl]-3,5-bis(trimethylsilyl)pyridin-2-one |
| SMILES | C/C=C/c1c([Si](C)(C)C)c(/C=C/C)n(CC)c(=O)c1[Si](C)(C)C |
| InChI | InChI=1S/C19H33NOSi2/c1-10-13-15-17(22(4,5)6)16(14-11-2)20(12-3)19(21)18(15)23(7,8)9/h10-11,13-14H,12H2,1-9H3/b13-10+,14-11+ |
| InChIKey | RLSRCESPZIMEOE-IFQMDVHZSA-N |
| XLogP | 4.02 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.65 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-4,6-bis[(E)-prop-1-enyl]-3,5-bis(trimethylsilyl)pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-4,6-bis[(E)-prop-1-enyl]-3,5-bis(trimethylsilyl)pyridin-2-one?
The IUPAC name of 1-ethyl-4,6-bis[(E)-prop-1-enyl]-3,5-bis(trimethylsilyl)pyridin-2-one (CID 11631619) is 1-ethyl-4,6-bis[(E)-prop-1-enyl]-3,5-bis(trimethylsilyl)pyridin-2-one.
What is the SMILES notation for 1-ethyl-4,6-bis[(E)-prop-1-enyl]-3,5-bis(trimethylsilyl)pyridin-2-one?
The canonical SMILES for 1-ethyl-4,6-bis[(E)-prop-1-enyl]-3,5-bis(trimethylsilyl)pyridin-2-one is C/C=C/c1c([Si](C)(C)C)c(/C=C/C)n(CC)c(=O)c1[Si](C)(C)C.
What is the InChIKey of 1-ethyl-4,6-bis[(E)-prop-1-enyl]-3,5-bis(trimethylsilyl)pyridin-2-one?
The InChIKey is RLSRCESPZIMEOE-IFQMDVHZSA-N. The full InChI is InChI=1S/C19H33NOSi2/c1-10-13-15-17(22(4,5)6)16(14-11-2)20(12-3)19(21)18(15)23(7,8)9/h10-11,13-14H,12H2,1-9H3/b13-10+,14-11+.
What are the key properties of 1-ethyl-4,6-bis[(E)-prop-1-enyl]-3,5-bis(trimethylsilyl)pyridin-2-one?
1-ethyl-4,6-bis[(E)-prop-1-enyl]-3,5-bis(trimethylsilyl)pyridin-2-one has a molecular weight of 347.65 g/mol, XLogP of 4.02, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-4,6-bis[(E)-prop-1-enyl]-3,5-bis(trimethylsilyl)pyridin-2-one is sourced from PubChem (CID 11631619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).