C17H11F3N2OS — CID 11631624
N-(2,4-diphenyl-1,3-thiazol-5-yl)-2,2,2-trifluoroacetamide (PubChem CID 11631624) has the molecular formula C17H11F3N2OS and a molecular weight of 348.35 g/mol. Its IUPAC name is N-(2,4-diphenyl-1,3-thiazol-5-yl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(2,4-diphenyl-1,3-thiazol-5-yl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 11631624 |
| Molecular Formula | C17H11F3N2OS |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | N-(2,4-diphenyl-1,3-thiazol-5-yl)-2,2,2-trifluoroacetamide |
| SMILES | O=C(Nc1sc(-c2ccccc2)nc1-c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C17H11F3N2OS/c18-17(19,20)16(23)22-15-13(11-7-3-1-4-8-11)21-14(24-15)12-9-5-2-6-10-12/h1-10H,(H,22,23) |
| InChIKey | IIFWRVPGNJBBAB-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |