About 3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]benzoic acid
3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]benzoic acid (PubChem CID 11631641) has the molecular formula C16H10F3N3O3
and a molecular weight of 349.27 g/mol. Its IUPAC name is 3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]benzoic acid.
Molecular Properties
| Compound Name | 3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]benzoic acid |
| PubChem CID | 11631641 |
| Molecular Formula | C16H10F3N3O3 |
| Molecular Weight | 349.27 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]benzoic acid |
| SMILES | O=C(O)c1cccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)c1 |
| InChI | InChI=1S/C16H10F3N3O3/c17-16(18,19)25-13-6-4-12(5-7-13)22-9-20-14(21-22)10-2-1-3-11(8-10)15(23)24/h1-9H,(H,23,24) |
| InChIKey | JMPGGBIVEQYVJU-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.27 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]benzoic acid?
The IUPAC name of 3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]benzoic acid (CID 11631641) is 3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]benzoic acid.
What is the SMILES notation for 3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]benzoic acid?
The canonical SMILES for 3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]benzoic acid is O=C(O)c1cccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)c1.
What is the InChIKey of 3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]benzoic acid?
The InChIKey is JMPGGBIVEQYVJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10F3N3O3/c17-16(18,19)25-13-6-4-12(5-7-13)22-9-20-14(21-22)10-2-1-3-11(8-10)15(23)24/h1-9H,(H,23,24).
What are the key properties of 3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]benzoic acid?
3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]benzoic acid has a molecular weight of 349.27 g/mol, XLogP of 3.53, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]benzoic acid is sourced from PubChem (CID 11631641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).