About 5-bromo-6-(1,2-diphenylethyl)pyridin-2-amine
5-bromo-6-(1,2-diphenylethyl)pyridin-2-amine (PubChem CID 11631702) has the molecular formula C19H17BrN2
and a molecular weight of 353.26 g/mol. Its IUPAC name is 5-bromo-6-(1,2-diphenylethyl)pyridin-2-amine.
Molecular Properties
| Compound Name | 5-bromo-6-(1,2-diphenylethyl)pyridin-2-amine |
| PubChem CID | 11631702 |
| Molecular Formula | C19H17BrN2 |
| Molecular Weight | 353.26 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | 5-bromo-6-(1,2-diphenylethyl)pyridin-2-amine |
| SMILES | Nc1ccc(Br)c(C(Cc2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C19H17BrN2/c20-17-11-12-18(21)22-19(17)16(15-9-5-2-6-10-15)13-14-7-3-1-4-8-14/h1-12,16H,13H2,(H2,21,22) |
| InChIKey | KENGBCSMINTFRF-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.26 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromo-6-(1,2-diphenylethyl)pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-6-(1,2-diphenylethyl)pyridin-2-amine?
The IUPAC name of 5-bromo-6-(1,2-diphenylethyl)pyridin-2-amine (CID 11631702) is 5-bromo-6-(1,2-diphenylethyl)pyridin-2-amine.
What is the SMILES notation for 5-bromo-6-(1,2-diphenylethyl)pyridin-2-amine?
The canonical SMILES for 5-bromo-6-(1,2-diphenylethyl)pyridin-2-amine is Nc1ccc(Br)c(C(Cc2ccccc2)c2ccccc2)n1.
What is the InChIKey of 5-bromo-6-(1,2-diphenylethyl)pyridin-2-amine?
The InChIKey is KENGBCSMINTFRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17BrN2/c20-17-11-12-18(21)22-19(17)16(15-9-5-2-6-10-15)13-14-7-3-1-4-8-14/h1-12,16H,13H2,(H2,21,22).
What are the key properties of 5-bromo-6-(1,2-diphenylethyl)pyridin-2-amine?
5-bromo-6-(1,2-diphenylethyl)pyridin-2-amine has a molecular weight of 353.26 g/mol, XLogP of 4.80, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-6-(1,2-diphenylethyl)pyridin-2-amine is sourced from PubChem (CID 11631702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).