About 2-[8-fluoro-2-(thiophene-2-carbonyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]acetic acid
2-[8-fluoro-2-(thiophene-2-carbonyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]acetic acid (PubChem CID 11631813) has the molecular formula C18H15FN2O3S
and a molecular weight of 358.39 g/mol. Its IUPAC name is 2-[8-fluoro-2-(thiophene-2-carbonyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[8-fluoro-2-(thiophene-2-carbonyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]acetic acid |
| PubChem CID | 11631813 |
| Molecular Formula | C18H15FN2O3S |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | 2-[8-fluoro-2-(thiophene-2-carbonyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]acetic acid |
| SMILES | O=C(O)Cn1c2c(c3cc(F)ccc31)CN(C(=O)c1cccs1)CC2 |
| InChI | InChI=1S/C18H15FN2O3S/c19-11-3-4-14-12(8-11)13-9-20(18(24)16-2-1-7-25-16)6-5-15(13)21(14)10-17(22)23/h1-4,7-8H,5-6,9-10H2,(H,22,23) |
| InChIKey | VXAZUHZNPMCSLD-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze 2-[8-fluoro-2-(thiophene-2-carbonyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[8-fluoro-2-(thiophene-2-carbonyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]acetic acid?
The IUPAC name of 2-[8-fluoro-2-(thiophene-2-carbonyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]acetic acid (CID 11631813) is 2-[8-fluoro-2-(thiophene-2-carbonyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]acetic acid.
What is the SMILES notation for 2-[8-fluoro-2-(thiophene-2-carbonyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]acetic acid?
The canonical SMILES for 2-[8-fluoro-2-(thiophene-2-carbonyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]acetic acid is O=C(O)Cn1c2c(c3cc(F)ccc31)CN(C(=O)c1cccs1)CC2.
What is the InChIKey of 2-[8-fluoro-2-(thiophene-2-carbonyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]acetic acid?
The InChIKey is VXAZUHZNPMCSLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15FN2O3S/c19-11-3-4-14-12(8-11)13-9-20(18(24)16-2-1-7-25-16)6-5-15(13)21(14)10-17(22)23/h1-4,7-8H,5-6,9-10H2,(H,22,23).
What are the key properties of 2-[8-fluoro-2-(thiophene-2-carbonyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]acetic acid?
2-[8-fluoro-2-(thiophene-2-carbonyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]acetic acid has a molecular weight of 358.39 g/mol, XLogP of 3.12, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[8-fluoro-2-(thiophene-2-carbonyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]acetic acid is sourced from PubChem (CID 11631813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).