C20H24O6 — CID 11631863
(1R,2S,3R,4R,6R)-4-(hydroxymethyl)-6-[2-[(4-hydroxyphenyl)methyl]phenoxy]cyclohexane-1,2,3-triol (PubChem CID 11631863) has the molecular formula C20H24O6 and a molecular weight of 360.41 g/mol. Its IUPAC name is (1R,2S,3R,4R,6R)-4-(hydroxymethyl)-6-[2-[(4-hydroxyphenyl)methyl]phenoxy]cyclohexane-1,2,3-triol.
| Compound Name | (1R,2S,3R,4R,6R)-4-(hydroxymethyl)-6-[2-[(4-hydroxyphenyl)methyl]phenoxy]cyclohexane-1,2,3-triol |
|---|---|
| PubChem CID | 11631863 |
| Molecular Formula | C20H24O6 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | (1R,2S,3R,4R,6R)-4-(hydroxymethyl)-6-[2-[(4-hydroxyphenyl)methyl]phenoxy]cyclohexane-1,2,3-triol |
| SMILES | OC[C@H]1C[C@@H](Oc2ccccc2Cc2ccc(O)cc2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H24O6/c21-11-14-10-17(19(24)20(25)18(14)23)26-16-4-2-1-3-13(16)9-12-5-7-15(22)8-6-12/h1-8,14,17-25H,9-11H2/t14-,17-,18-,19+,20+/m1/s1 |
| InChIKey | UEAZXOKIWVKQGJ-SBUWESJJSA-N |
| XLogP | 0.83 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |