About 1-[4-(6-methoxynaphthalen-1-yl)butyl]-3,3-dimethylpiperidine;hydrochloride
1-[4-(6-methoxynaphthalen-1-yl)butyl]-3,3-dimethylpiperidine;hydrochloride (PubChem CID 11631897) has the molecular formula C22H32ClNO
and a molecular weight of 361.96 g/mol. Its IUPAC name is 1-[4-(6-methoxynaphthalen-1-yl)butyl]-3,3-dimethylpiperidine;hydrochloride.
Molecular Properties
| Compound Name | 1-[4-(6-methoxynaphthalen-1-yl)butyl]-3,3-dimethylpiperidine;hydrochloride |
| PubChem CID | 11631897 |
| Molecular Formula | C22H32ClNO |
| Molecular Weight | 361.96 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | 1-[4-(6-methoxynaphthalen-1-yl)butyl]-3,3-dimethylpiperidine;hydrochloride |
| SMILES | COc1ccc2c(CCCCN3CCCC(C)(C)C3)cccc2c1.Cl |
| InChI | InChI=1S/C22H31NO.ClH/c1-22(2)13-7-15-23(17-22)14-5-4-8-18-9-6-10-19-16-20(24-3)11-12-21(18)19;/h6,9-12,16H,4-5,7-8,13-15,17H2,1-3H3;1H |
| InChIKey | RYDDKYSKNLTOCC-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 361.96 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(6-methoxynaphthalen-1-yl)butyl]-3,3-dimethylpiperidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(6-methoxynaphthalen-1-yl)butyl]-3,3-dimethylpiperidine;hydrochloride?
The IUPAC name of 1-[4-(6-methoxynaphthalen-1-yl)butyl]-3,3-dimethylpiperidine;hydrochloride (CID 11631897) is 1-[4-(6-methoxynaphthalen-1-yl)butyl]-3,3-dimethylpiperidine;hydrochloride.
What is the SMILES notation for 1-[4-(6-methoxynaphthalen-1-yl)butyl]-3,3-dimethylpiperidine;hydrochloride?
The canonical SMILES for 1-[4-(6-methoxynaphthalen-1-yl)butyl]-3,3-dimethylpiperidine;hydrochloride is COc1ccc2c(CCCCN3CCCC(C)(C)C3)cccc2c1.Cl.
What is the InChIKey of 1-[4-(6-methoxynaphthalen-1-yl)butyl]-3,3-dimethylpiperidine;hydrochloride?
The InChIKey is RYDDKYSKNLTOCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H31NO.ClH/c1-22(2)13-7-15-23(17-22)14-5-4-8-18-9-6-10-19-16-20(24-3)11-12-21(18)19;/h6,9-12,16H,4-5,7-8,13-15,17H2,1-3H3;1H.
What are the key properties of 1-[4-(6-methoxynaphthalen-1-yl)butyl]-3,3-dimethylpiperidine;hydrochloride?
1-[4-(6-methoxynaphthalen-1-yl)butyl]-3,3-dimethylpiperidine;hydrochloride has a molecular weight of 361.96 g/mol, XLogP of 5.71, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(6-methoxynaphthalen-1-yl)butyl]-3,3-dimethylpiperidine;hydrochloride is sourced from PubChem (CID 11631897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).