C17H11F3N6O — CID 11632139
1-(4,6,8,9-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,7,10,12-hexaen-3-yl)-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 11632139) has the molecular formula C17H11F3N6O and a molecular weight of 372.31 g/mol. Its IUPAC name is 1-(4,6,8,9-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,7,10,12-hexaen-3-yl)-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(4,6,8,9-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,7,10,12-hexaen-3-yl)-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 11632139 |
| Molecular Formula | C17H11F3N6O |
| Molecular Weight | 372.31 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 1-(4,6,8,9-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,7,10,12-hexaen-3-yl)-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)Nc1ncnc2nn3ccccc3c12 |
| InChI | InChI=1S/C17H11F3N6O/c18-17(19,20)10-4-3-5-11(8-10)23-16(27)24-14-13-12-6-1-2-7-26(12)25-15(13)22-9-21-14/h1-9H,(H2,21,22,23,24,25,27) |
| InChIKey | BQWBZBFRJHWSEA-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 84.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.31 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |