About methyl 5-[(3-hydroxy-2,4-dioxo-[1]benzothiolo[3,2-d]pyrimidin-1-yl)methyl]furan-2-carboxylate
methyl 5-[(3-hydroxy-2,4-dioxo-[1]benzothiolo[3,2-d]pyrimidin-1-yl)methyl]furan-2-carboxylate (PubChem CID 11632142) has the molecular formula C17H12N2O6S
and a molecular weight of 372.36 g/mol. Its IUPAC name is methyl 5-[(3-hydroxy-2,4-dioxo-[1]benzothiolo[3,2-d]pyrimidin-1-yl)methyl]furan-2-carboxylate.
Molecular Properties
| Compound Name | methyl 5-[(3-hydroxy-2,4-dioxo-[1]benzothiolo[3,2-d]pyrimidin-1-yl)methyl]furan-2-carboxylate |
| PubChem CID | 11632142 |
| Molecular Formula | C17H12N2O6S |
| Molecular Weight | 372.36 g/mol |
| Exact Mass | 372.04 |
| IUPAC Name | methyl 5-[(3-hydroxy-2,4-dioxo-[1]benzothiolo[3,2-d]pyrimidin-1-yl)methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(Cn2c(=O)n(O)c(=O)c3sc4ccccc4c32)o1 |
| InChI | InChI=1S/C17H12N2O6S/c1-24-16(21)11-7-6-9(25-11)8-18-13-10-4-2-3-5-12(10)26-14(13)15(20)19(23)17(18)22/h2-7,23H,8H2,1H3 |
| InChIKey | HSXYHTHKKKFFEA-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 103.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.36 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-[(3-hydroxy-2,4-dioxo-[1]benzothiolo[3,2-d]pyrimidin-1-yl)methyl]furan-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[(3-hydroxy-2,4-dioxo-[1]benzothiolo[3,2-d]pyrimidin-1-yl)methyl]furan-2-carboxylate?
The IUPAC name of methyl 5-[(3-hydroxy-2,4-dioxo-[1]benzothiolo[3,2-d]pyrimidin-1-yl)methyl]furan-2-carboxylate (CID 11632142) is methyl 5-[(3-hydroxy-2,4-dioxo-[1]benzothiolo[3,2-d]pyrimidin-1-yl)methyl]furan-2-carboxylate.
What is the SMILES notation for methyl 5-[(3-hydroxy-2,4-dioxo-[1]benzothiolo[3,2-d]pyrimidin-1-yl)methyl]furan-2-carboxylate?
The canonical SMILES for methyl 5-[(3-hydroxy-2,4-dioxo-[1]benzothiolo[3,2-d]pyrimidin-1-yl)methyl]furan-2-carboxylate is COC(=O)c1ccc(Cn2c(=O)n(O)c(=O)c3sc4ccccc4c32)o1.
What is the InChIKey of methyl 5-[(3-hydroxy-2,4-dioxo-[1]benzothiolo[3,2-d]pyrimidin-1-yl)methyl]furan-2-carboxylate?
The InChIKey is HSXYHTHKKKFFEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12N2O6S/c1-24-16(21)11-7-6-9(25-11)8-18-13-10-4-2-3-5-12(10)26-14(13)15(20)19(23)17(18)22/h2-7,23H,8H2,1H3.
What are the key properties of methyl 5-[(3-hydroxy-2,4-dioxo-[1]benzothiolo[3,2-d]pyrimidin-1-yl)methyl]furan-2-carboxylate?
methyl 5-[(3-hydroxy-2,4-dioxo-[1]benzothiolo[3,2-d]pyrimidin-1-yl)methyl]furan-2-carboxylate has a molecular weight of 372.36 g/mol, XLogP of 2.04, 3 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[(3-hydroxy-2,4-dioxo-[1]benzothiolo[3,2-d]pyrimidin-1-yl)methyl]furan-2-carboxylate is sourced from PubChem (CID 11632142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).