C20H14ClN5O — CID 11632212
1-(3-chlorophenyl)-N,5-dipyridin-4-ylpyrazole-3-carboxamide (PubChem CID 11632212) has the molecular formula C20H14ClN5O and a molecular weight of 375.82 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N,5-dipyridin-4-ylpyrazole-3-carboxamide.
| Compound Name | 1-(3-chlorophenyl)-N,5-dipyridin-4-ylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 11632212 |
| Molecular Formula | C20H14ClN5O |
| Molecular Weight | 375.82 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | 1-(3-chlorophenyl)-N,5-dipyridin-4-ylpyrazole-3-carboxamide |
| SMILES | O=C(Nc1ccncc1)c1cc(-c2ccncc2)n(-c2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C20H14ClN5O/c21-15-2-1-3-17(12-15)26-19(14-4-8-22-9-5-14)13-18(25-26)20(27)24-16-6-10-23-11-7-16/h1-13H,(H,23,24,27) |
| InChIKey | MZPPYCXHHZYTFL-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.82 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |