C12H16N4O4S3 — CID 11632228
5-[(4-tert-butylphenyl)sulfonylamino]-1,3,4-thiadiazole-2-sulfonamide (PubChem CID 11632228) has the molecular formula C12H16N4O4S3 and a molecular weight of 376.49 g/mol. Its IUPAC name is 5-[(4-tert-butylphenyl)sulfonylamino]-1,3,4-thiadiazole-2-sulfonamide.
| Compound Name | 5-[(4-tert-butylphenyl)sulfonylamino]-1,3,4-thiadiazole-2-sulfonamide |
|---|---|
| PubChem CID | 11632228 |
| Molecular Formula | C12H16N4O4S3 |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.03 |
| IUPAC Name | 5-[(4-tert-butylphenyl)sulfonylamino]-1,3,4-thiadiazole-2-sulfonamide |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)Nc2nnc(S(N)(=O)=O)s2)cc1 |
| InChI | InChI=1S/C12H16N4O4S3/c1-12(2,3)8-4-6-9(7-5-8)23(19,20)16-10-14-15-11(21-10)22(13,17)18/h4-7H,1-3H3,(H,14,16)(H2,13,17,18) |
| InChIKey | XJTLHCNJZZEQCS-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 132.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |