About (16-acetyloxy-11-hydroxyoctadec-17-en-12,14-diynyl) acetate
(16-acetyloxy-11-hydroxyoctadec-17-en-12,14-diynyl) acetate (PubChem CID 11632231) has the molecular formula C22H32O5
and a molecular weight of 376.49 g/mol. Its IUPAC name is (16-acetyloxy-11-hydroxyoctadec-17-en-12,14-diynyl) acetate.
Molecular Properties
| Compound Name | (16-acetyloxy-11-hydroxyoctadec-17-en-12,14-diynyl) acetate |
| PubChem CID | 11632231 |
| Molecular Formula | C22H32O5 |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | (16-acetyloxy-11-hydroxyoctadec-17-en-12,14-diynyl) acetate |
| SMILES | C=CC(C#CC#CC(O)CCCCCCCCCCOC(C)=O)OC(C)=O |
| InChI | InChI=1S/C22H32O5/c1-4-22(27-20(3)24)17-13-12-16-21(25)15-11-9-7-5-6-8-10-14-18-26-19(2)23/h4,21-22,25H,1,5-11,14-15,18H2,2-3H3 |
| InChIKey | AVKOLTWNMGUSAT-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (16-acetyloxy-11-hydroxyoctadec-17-en-12,14-diynyl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (16-acetyloxy-11-hydroxyoctadec-17-en-12,14-diynyl) acetate?
The IUPAC name of (16-acetyloxy-11-hydroxyoctadec-17-en-12,14-diynyl) acetate (CID 11632231) is (16-acetyloxy-11-hydroxyoctadec-17-en-12,14-diynyl) acetate.
What is the SMILES notation for (16-acetyloxy-11-hydroxyoctadec-17-en-12,14-diynyl) acetate?
The canonical SMILES for (16-acetyloxy-11-hydroxyoctadec-17-en-12,14-diynyl) acetate is C=CC(C#CC#CC(O)CCCCCCCCCCOC(C)=O)OC(C)=O.
What is the InChIKey of (16-acetyloxy-11-hydroxyoctadec-17-en-12,14-diynyl) acetate?
The InChIKey is AVKOLTWNMGUSAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H32O5/c1-4-22(27-20(3)24)17-13-12-16-21(25)15-11-9-7-5-6-8-10-14-18-26-19(2)23/h4,21-22,25H,1,5-11,14-15,18H2,2-3H3.
What are the key properties of (16-acetyloxy-11-hydroxyoctadec-17-en-12,14-diynyl) acetate?
(16-acetyloxy-11-hydroxyoctadec-17-en-12,14-diynyl) acetate has a molecular weight of 376.49 g/mol, XLogP of 3.55, 13 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (16-acetyloxy-11-hydroxyoctadec-17-en-12,14-diynyl) acetate is sourced from PubChem (CID 11632231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).