C19H24FN3O2S — CID 11632254
N-[(3R,4S)-4-[4-(6-fluoro-3-pyridinyl)phenyl]-1-methylpyrrolidin-3-yl]propane-2-sulfonamide (PubChem CID 11632254) has the molecular formula C19H24FN3O2S and a molecular weight of 377.49 g/mol. Its IUPAC name is N-[(3R,4S)-4-[4-(6-fluoro-3-pyridinyl)phenyl]-1-methylpyrrolidin-3-yl]propane-2-sulfonamide.
| Compound Name | N-[(3R,4S)-4-[4-(6-fluoro-3-pyridinyl)phenyl]-1-methylpyrrolidin-3-yl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 11632254 |
| Molecular Formula | C19H24FN3O2S |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | N-[(3R,4S)-4-[4-(6-fluoro-3-pyridinyl)phenyl]-1-methylpyrrolidin-3-yl]propane-2-sulfonamide |
| SMILES | CC(C)S(=O)(=O)N[C@H]1CN(C)C[C@@H]1c1ccc(-c2ccc(F)nc2)cc1 |
| InChI | InChI=1S/C19H24FN3O2S/c1-13(2)26(24,25)22-18-12-23(3)11-17(18)15-6-4-14(5-7-15)16-8-9-19(20)21-10-16/h4-10,13,17-18,22H,11-12H2,1-3H3/t17-,18+/m1/s1 |
| InChIKey | WOMJVSPWJXCHGN-MSOLQXFVSA-N |
| XLogP | 2.61 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|