C21H26N6O2 — CID 11632605
N-hydroxy-2-[4-[[(1-methylindol-6-yl)methylamino]methyl]piperidin-1-yl]pyrimidine-5-carboxamide (PubChem CID 11632605) has the molecular formula C21H26N6O2 and a molecular weight of 394.48 g/mol. Its IUPAC name is N-hydroxy-2-[4-[[(1-methylindol-6-yl)methylamino]methyl]piperidin-1-yl]pyrimidine-5-carboxamide.
| Compound Name | N-hydroxy-2-[4-[[(1-methylindol-6-yl)methylamino]methyl]piperidin-1-yl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 11632605 |
| Molecular Formula | C21H26N6O2 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | N-hydroxy-2-[4-[[(1-methylindol-6-yl)methylamino]methyl]piperidin-1-yl]pyrimidine-5-carboxamide |
| SMILES | Cn1ccc2ccc(CNCC3CCN(c4ncc(C(=O)NO)cn4)CC3)cc21 |
| InChI | InChI=1S/C21H26N6O2/c1-26-7-6-17-3-2-16(10-19(17)26)12-22-11-15-4-8-27(9-5-15)21-23-13-18(14-24-21)20(28)25-29/h2-3,6-7,10,13-15,22,29H,4-5,8-9,11-12H2,1H3,(H,25,28) |
| InChIKey | VMSYDCOTIBYQBY-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 95.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|