C24H22FN5O — CID 11633041
8-[3-(2-fluoro-3-pyridinyl)phenyl]-8-(4-methoxyphenyl)-3,4-dihydro-2H-imidazo[1,5-a]pyrimidin-6-amine (PubChem CID 11633041) has the molecular formula C24H22FN5O and a molecular weight of 415.47 g/mol. Its IUPAC name is 8-[3-(2-fluoro-3-pyridinyl)phenyl]-8-(4-methoxyphenyl)-3,4-dihydro-2H-imidazo[1,5-a]pyrimidin-6-amine.
| Compound Name | 8-[3-(2-fluoro-3-pyridinyl)phenyl]-8-(4-methoxyphenyl)-3,4-dihydro-2H-imidazo[1,5-a]pyrimidin-6-amine |
|---|---|
| PubChem CID | 11633041 |
| Molecular Formula | C24H22FN5O |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 8-[3-(2-fluoro-3-pyridinyl)phenyl]-8-(4-methoxyphenyl)-3,4-dihydro-2H-imidazo[1,5-a]pyrimidin-6-amine |
| SMILES | COc1ccc(C2(c3cccc(-c4cccnc4F)c3)N=C(N)N3CCCN=C32)cc1 |
| InChI | InChI=1S/C24H22FN5O/c1-31-19-10-8-17(9-11-19)24(22-28-13-4-14-30(22)23(26)29-24)18-6-2-5-16(15-18)20-7-3-12-27-21(20)25/h2-3,5-12,15H,4,13-14H2,1H3,(H2,26,29) |
| InChIKey | PIONCLLNBJJWDA-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|