C25H32N6 — CID 11633069
(8S)-N-[[5-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)imidazo[1,2-a]pyridin-2-yl]methyl]-N-methyl-5,6,7,8-tetrahydroquinolin-8-amine (PubChem CID 11633069) has the molecular formula C25H32N6 and a molecular weight of 416.57 g/mol. Its IUPAC name is (8S)-N-[[5-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)imidazo[1,2-a]pyridin-2-yl]methyl]-N-methyl-5,6,7,8-tetrahydroquinolin-8-amine.
| Compound Name | (8S)-N-[[5-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)imidazo[1,2-a]pyridin-2-yl]methyl]-N-methyl-5,6,7,8-tetrahydroquinolin-8-amine |
|---|---|
| PubChem CID | 11633069 |
| Molecular Formula | C25H32N6 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.27 |
| IUPAC Name | (8S)-N-[[5-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)imidazo[1,2-a]pyridin-2-yl]methyl]-N-methyl-5,6,7,8-tetrahydroquinolin-8-amine |
| SMILES | CN(Cc1cn2c(N3CCN4CCCC4C3)cccc2n1)[C@H]1CCCc2cccnc21 |
| InChI | InChI=1S/C25H32N6/c1-28(22-9-2-6-19-7-4-12-26-25(19)22)16-20-17-31-23(27-20)10-3-11-24(31)30-15-14-29-13-5-8-21(29)18-30/h3-4,7,10-12,17,21-22H,2,5-6,8-9,13-16,18H2,1H3/t21?,22-/m0/s1 |
| InChIKey | RZBMNHLGYITPKH-KEKNWZKVSA-N |
| XLogP | 3.52 |
| TPSA | 39.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |