C22H26O8 — CID 11633104
(3R,4R)-3,4-bis[(4-hydroxy-3,5-dimethoxyphenyl)methyl]oxolan-2-one (PubChem CID 11633104) has the molecular formula C22H26O8 and a molecular weight of 418.44 g/mol. Its IUPAC name is (3R,4R)-3,4-bis[(4-hydroxy-3,5-dimethoxyphenyl)methyl]oxolan-2-one.
| Compound Name | (3R,4R)-3,4-bis[(4-hydroxy-3,5-dimethoxyphenyl)methyl]oxolan-2-one |
|---|---|
| PubChem CID | 11633104 |
| Molecular Formula | C22H26O8 |
| Molecular Weight | 418.44 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | (3R,4R)-3,4-bis[(4-hydroxy-3,5-dimethoxyphenyl)methyl]oxolan-2-one |
| SMILES | COc1cc(C[C@H]2COC(=O)[C@@H]2Cc2cc(OC)c(O)c(OC)c2)cc(OC)c1O |
| InChI | InChI=1S/C22H26O8/c1-26-16-7-12(8-17(27-2)20(16)23)5-14-11-30-22(25)15(14)6-13-9-18(28-3)21(24)19(10-13)29-4/h7-10,14-15,23-24H,5-6,11H2,1-4H3/t14-,15+/m0/s1 |
| InChIKey | FOKBVCBNGPPEGA-LSDHHAIUSA-N |
| XLogP | 2.71 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.44 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |