C22H26N6O3 — CID 11633189
8-[1-[(4-methoxyphenyl)methyl]pyrazol-4-yl]-1,3-dipropyl-7H-purine-2,6-dione (PubChem CID 11633189) has the molecular formula C22H26N6O3 and a molecular weight of 422.49 g/mol. Its IUPAC name is 8-[1-[(4-methoxyphenyl)methyl]pyrazol-4-yl]-1,3-dipropyl-7H-purine-2,6-dione.
| Compound Name | 8-[1-[(4-methoxyphenyl)methyl]pyrazol-4-yl]-1,3-dipropyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 11633189 |
| Molecular Formula | C22H26N6O3 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | 8-[1-[(4-methoxyphenyl)methyl]pyrazol-4-yl]-1,3-dipropyl-7H-purine-2,6-dione |
| SMILES | CCCn1c(=O)c2[nH]c(-c3cnn(Cc4ccc(OC)cc4)c3)nc2n(CCC)c1=O |
| InChI | InChI=1S/C22H26N6O3/c1-4-10-27-20-18(21(29)28(11-5-2)22(27)30)24-19(25-20)16-12-23-26(14-16)13-15-6-8-17(31-3)9-7-15/h6-9,12,14H,4-5,10-11,13H2,1-3H3,(H,24,25) |
| InChIKey | NKPLNJOYETWKDI-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 99.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |