C26H30O5 — CID 11633192
[(1R,5R,9S)-1-[(1E)-2,6-dimethylhepta-1,5-dienyl]-3,6-dioxo-2-oxaspiro[4.5]dec-7-en-9-yl] 4-methylbenzoate (PubChem CID 11633192) has the molecular formula C26H30O5 and a molecular weight of 422.52 g/mol. Its IUPAC name is [(1R,5R,9S)-1-[(1E)-2,6-dimethylhepta-1,5-dienyl]-3,6-dioxo-2-oxaspiro[4.5]dec-7-en-9-yl] 4-methylbenzoate.
| Compound Name | [(1R,5R,9S)-1-[(1E)-2,6-dimethylhepta-1,5-dienyl]-3,6-dioxo-2-oxaspiro[4.5]dec-7-en-9-yl] 4-methylbenzoate |
|---|---|
| PubChem CID | 11633192 |
| Molecular Formula | C26H30O5 |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | [(1R,5R,9S)-1-[(1E)-2,6-dimethylhepta-1,5-dienyl]-3,6-dioxo-2-oxaspiro[4.5]dec-7-en-9-yl] 4-methylbenzoate |
| SMILES | CC(C)=CCC/C(C)=C/[C@H]1OC(=O)C[C@]12C[C@H](OC(=O)c1ccc(C)cc1)C=CC2=O |
| InChI | InChI=1S/C26H30O5/c1-17(2)6-5-7-19(4)14-23-26(16-24(28)31-23)15-21(12-13-22(26)27)30-25(29)20-10-8-18(3)9-11-20/h6,8-14,21,23H,5,7,15-16H2,1-4H3/b19-14+/t21-,23-,26+/m1/s1 |
| InChIKey | QUNUHOYWLDZMIE-PQACFKHGSA-N |
| XLogP | 5.04 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|