C19H13N3O5S2 — CID 11633286
[2-(5-methyl-1,2-oxazol-3-yl)-1,3-thiazol-4-yl]methyl 4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]benzoate (PubChem CID 11633286) has the molecular formula C19H13N3O5S2 and a molecular weight of 427.46 g/mol. Its IUPAC name is [2-(5-methyl-1,2-oxazol-3-yl)-1,3-thiazol-4-yl]methyl 4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]benzoate.
| Compound Name | [2-(5-methyl-1,2-oxazol-3-yl)-1,3-thiazol-4-yl]methyl 4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]benzoate |
|---|---|
| PubChem CID | 11633286 |
| Molecular Formula | C19H13N3O5S2 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.03 |
| IUPAC Name | [2-(5-methyl-1,2-oxazol-3-yl)-1,3-thiazol-4-yl]methyl 4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]benzoate |
| SMILES | Cc1cc(-c2nc(COC(=O)c3ccc(/C=C4\SC(=O)NC4=O)cc3)cs2)no1 |
| InChI | InChI=1S/C19H13N3O5S2/c1-10-6-14(22-27-10)17-20-13(9-28-17)8-26-18(24)12-4-2-11(3-5-12)7-15-16(23)21-19(25)29-15/h2-7,9H,8H2,1H3,(H,21,23,25)/b15-7- |
| InChIKey | CFQMEWUXYSIXTQ-CHHVJCJISA-N |
| XLogP | 3.79 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|